C59H46F3N5O3S — CID 165149416
[2-[4-[2-[3,5-bis[2-[4-(1-phenylimidazol-2-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-5-methyl-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 165149416) has the molecular formula C59H46F3N5O3S and a molecular weight of 962.11 g/mol. Its IUPAC name is [2-[4-[2-[3,5-bis[2-[4-(1-phenylimidazol-2-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-5-methyl-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [2-[4-[2-[3,5-bis[2-[4-(1-phenylimidazol-2-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-5-methyl-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165149416 |
| Molecular Formula | C59H46F3N5O3S |
| Molecular Weight | 962.11 g/mol |
| Exact Mass | 961.33 |
| IUPAC Name | [2-[4-[2-[3,5-bis[2-[4-(1-phenylimidazol-2-yl)phenyl]ethyl]phenyl]phenyl]phenyl]-5-methyl-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1cnc(-c2ccc(-c3ccccc3-c3cc(CCc4ccc(-c5nccn5-c5ccccc5)cc4)cc(CCc4ccc(-c5nccn5-c5ccccc5)cc4)c3)cc2)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C59H46F3N5O3S/c1-41-40-65-55(39-56(41)70-71(68,69)59(60,61)62)47-30-28-46(29-31-47)53-14-8-9-15-54(53)50-37-44(18-16-42-20-24-48(25-21-42)57-63-32-34-66(57)51-10-4-2-5-11-51)36-45(38-50)19-17-43-22-26-49(27-23-43)58-64-33-35-67(58)52-12-6-3-7-13-52/h2-15,20-40H,16-19H2,1H3 |
| InChIKey | ATENJBMZEGHGGR-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.11 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|