C9H13N3O6P+ — CID 165156020
[(2R,3S)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 165156020) has the molecular formula C9H13N3O6P+ and a molecular weight of 290.19 g/mol. Its IUPAC name is [(2R,3S)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 165156020 |
| Molecular Formula | C9H13N3O6P+ |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [(2R,3S)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | Cc1cn([C@@H]2OCC(O)[C@@H]2O[P+](=O)O)c(=O)nc1N |
| InChI | InChI=1S/C9H12N3O6P/c1-4-2-12(9(14)11-7(4)10)8-6(18-19(15)16)5(13)3-17-8/h2,5-6,8,13H,3H2,1H3,(H2-,10,11,14,15,16)/p+1/t5?,6-,8+/m0/s1 |
| InChIKey | FHBRZYDCPDDHCJ-KVWYPCGYSA-O |
| XLogP | -0.94 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|