C11H20NO- — CID 165157100
(Z)-3,3-dimethyl-1-piperidin-1-ylbut-1-en-2-olate (PubChem CID 165157100) has the molecular formula C11H20NO- and a molecular weight of 182.29 g/mol. Its IUPAC name is (Z)-3,3-dimethyl-1-piperidin-1-ylbut-1-en-2-olate.
| Compound Name | (Z)-3,3-dimethyl-1-piperidin-1-ylbut-1-en-2-olate |
|---|---|
| PubChem CID | 165157100 |
| Molecular Formula | C11H20NO- |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.16 |
| IUPAC Name | (Z)-3,3-dimethyl-1-piperidin-1-ylbut-1-en-2-olate |
| SMILES | CC(C)(C)/C([O-])=C/N1CCCCC1 |
| InChI | InChI=1S/C11H21NO/c1-11(2,3)10(13)9-12-7-5-4-6-8-12/h9,13H,4-8H2,1-3H3/p-1/b10-9- |
| InChIKey | MSQXSQYFSCZIDE-KTKRTIGZSA-M |
| XLogP | 1.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|