C25H22F3NO6 — CID 165157288
[4-[1-anilino-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate (PubChem CID 165157288) has the molecular formula C25H22F3NO6 and a molecular weight of 489.45 g/mol. Its IUPAC name is [4-[1-anilino-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate.
| Compound Name | [4-[1-anilino-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate |
|---|---|
| PubChem CID | 165157288 |
| Molecular Formula | C25H22F3NO6 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [4-[1-anilino-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate |
| SMILES | O=COCC1=C(COC=O)C2(C(Cc3ccc(OC(F)(F)F)cc3)Nc3ccccc3)C=CC1O2 |
| InChI | InChI=1S/C25H22F3NO6/c26-25(27,28)34-19-8-6-17(7-9-19)12-23(29-18-4-2-1-3-5-18)24-11-10-22(35-24)20(13-32-15-30)21(24)14-33-16-31/h1-11,15-16,22-23,29H,12-14H2 |
| InChIKey | QOSUPMPEXNRRSV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|