C26H36N8O5 — CID 165172442
tert-butyl (2S,4S)-2-(cyanomethyl)-4-[[2-[3-(dimethylamino)azetidin-1-yl]-8-methoxy-3-nitro-1,7-naphthyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 165172442) has the molecular formula C26H36N8O5 and a molecular weight of 540.63 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(cyanomethyl)-4-[[2-[3-(dimethylamino)azetidin-1-yl]-8-methoxy-3-nitro-1,7-naphthyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-(cyanomethyl)-4-[[2-[3-(dimethylamino)azetidin-1-yl]-8-methoxy-3-nitro-1,7-naphthyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 165172442 |
| Molecular Formula | C26H36N8O5 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | tert-butyl (2S,4S)-2-(cyanomethyl)-4-[[2-[3-(dimethylamino)azetidin-1-yl]-8-methoxy-3-nitro-1,7-naphthyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | COc1nccc2c(N[C@H]3CCN(C(=O)OC(C)(C)C)[C@H](CC#N)C3)c([N+](=O)[O-])c(N3CC(N(C)C)C3)nc12 |
| InChI | InChI=1S/C26H36N8O5/c1-26(2,3)39-25(35)33-12-9-16(13-17(33)7-10-27)29-20-19-8-11-28-24(38-6)21(19)30-23(22(20)34(36)37)32-14-18(15-32)31(4)5/h8,11,16-18H,7,9,12-15H2,1-6H3,(H,29,30)/t16-,17+/m0/s1 |
| InChIKey | DKIZXRAVRSOXPW-DLBZAZTESA-N |
| XLogP | 3.39 |
| TPSA | 149.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|