C16H22N4O6 — CID 165495551
tert-butyl 4-(4-methoxycarbonyl-3-nitro-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 165495551) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is tert-butyl 4-(4-methoxycarbonyl-3-nitro-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methoxycarbonyl-3-nitro-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 165495551 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | tert-butyl 4-(4-methoxycarbonyl-3-nitro-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccnc(N2CCN(C(=O)OC(C)(C)C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O6/c1-16(2,3)26-15(22)19-9-7-18(8-10-19)13-12(20(23)24)11(5-6-17-13)14(21)25-4/h5-6H,7-10H2,1-4H3 |
| InChIKey | JTBNKYNOULUVPJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 115.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|