C8AgF16NO3S — CID 165174782
silver 1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide (PubChem CID 165174782) has the molecular formula C8AgF16NO3S and a molecular weight of 601.99 g/mol. Its IUPAC name is silver 1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide.
| Compound Name | silver 1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide |
|---|---|
| PubChem CID | 165174782 |
| Molecular Formula | C8AgF16NO3S |
| Molecular Weight | 601.99 g/mol |
| Exact Mass | 600.84 |
| IUPAC Name | silver 1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide |
| SMILES | O=C([N-]S(=O)(=O)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ag+] |
| InChI | InChI=1S/C8HF16NO3S.Ag/c9-2(10,3(11,12)4(13,14)6(16,17)18)1(26)25-29(27,28)5(15,7(19,20)21)8(22,23)24;/h(H,25,26);/q;+1/p-1 |
| InChIKey | LMFURBDXPSDABP-UHFFFAOYSA-M |
| XLogP | 4.47 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|