C11H10F2N2S — CID 165175448
3,3-difluoro-1-[(4-isothiocyanatophenyl)methyl]azetidine (PubChem CID 165175448) has the molecular formula C11H10F2N2S and a molecular weight of 240.28 g/mol. Its IUPAC name is 3,3-difluoro-1-[(4-isothiocyanatophenyl)methyl]azetidine.
| Compound Name | 3,3-difluoro-1-[(4-isothiocyanatophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 165175448 |
| Molecular Formula | C11H10F2N2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3,3-difluoro-1-[(4-isothiocyanatophenyl)methyl]azetidine |
| SMILES | FC1(F)CN(Cc2ccc(N=C=S)cc2)C1 |
| InChI | InChI=1S/C11H10F2N2S/c12-11(13)6-15(7-11)5-9-1-3-10(4-2-9)14-8-16/h1-4H,5-7H2 |
| InChIKey | ZCITUDKQLMSUOO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|