About non-2-enylthiourea
non-2-enylthiourea (PubChem CID 165175598) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is non-2-enylthiourea.
Molecular Properties
| Compound Name | non-2-enylthiourea |
| PubChem CID | 165175598 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | non-2-enylthiourea |
| SMILES | CCCCCCC=CCNC(N)=S |
| InChI | InChI=1S/C10H20N2S/c1-2-3-4-5-6-7-8-9-12-10(11)13/h7-8H,2-6,9H2,1H3,(H3,11,12,13) |
| InChIKey | XHKYHOPDYUYFIO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze non-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-2-enylthiourea?
The IUPAC name of non-2-enylthiourea (CID 165175598) is non-2-enylthiourea.
What is the SMILES notation for non-2-enylthiourea?
The canonical SMILES for non-2-enylthiourea is CCCCCCC=CCNC(N)=S.
What is the InChIKey of non-2-enylthiourea?
The InChIKey is XHKYHOPDYUYFIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2S/c1-2-3-4-5-6-7-8-9-12-10(11)13/h7-8H,2-6,9H2,1H3,(H3,11,12,13).
What are the key properties of non-2-enylthiourea?
non-2-enylthiourea has a molecular weight of 200.35 g/mol, XLogP of 2.35, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for non-2-enylthiourea is sourced from PubChem (CID 165175598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).