About undec-2-enylthiourea
undec-2-enylthiourea (PubChem CID 165175602) has the molecular formula C12H24N2S
and a molecular weight of 228.40 g/mol. Its IUPAC name is undec-2-enylthiourea.
Molecular Properties
| Compound Name | undec-2-enylthiourea |
| PubChem CID | 165175602 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | undec-2-enylthiourea |
| SMILES | CCCCCCCCC=CCNC(N)=S |
| InChI | InChI=1S/C12H24N2S/c1-2-3-4-5-6-7-8-9-10-11-14-12(13)15/h9-10H,2-8,11H2,1H3,(H3,13,14,15) |
| InChIKey | WUAKWCOMOYEGPA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze undec-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-2-enylthiourea?
The IUPAC name of undec-2-enylthiourea (CID 165175602) is undec-2-enylthiourea.
What is the SMILES notation for undec-2-enylthiourea?
The canonical SMILES for undec-2-enylthiourea is CCCCCCCCC=CCNC(N)=S.
What is the InChIKey of undec-2-enylthiourea?
The InChIKey is WUAKWCOMOYEGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2S/c1-2-3-4-5-6-7-8-9-10-11-14-12(13)15/h9-10H,2-8,11H2,1H3,(H3,13,14,15).
What are the key properties of undec-2-enylthiourea?
undec-2-enylthiourea has a molecular weight of 228.40 g/mol, XLogP of 3.13, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undec-2-enylthiourea is sourced from PubChem (CID 165175602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).