C40H68NO8P — CID 165242149
[3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate (PubChem CID 165242149) has the molecular formula C40H68NO8P and a molecular weight of 721.96 g/mol. Its IUPAC name is [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate.
| Compound Name | [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate |
|---|---|
| PubChem CID | 165242149 |
| Molecular Formula | C40H68NO8P |
| Molecular Weight | 721.96 g/mol |
| Exact Mass | 721.47 |
| IUPAC Name | [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] nonanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCCC |
| InChI | InChI=1S/C40H68NO8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-30-32-39(43)41-34-35-48-50(45,46)49-37-38(42)36-47-40(44)33-31-29-10-8-6-4-2/h5,7,11-12,14-15,17-18,20-21,23-24,38,42H,3-4,6,8-10,13,16,19,22,25-37H2,1-2H3,(H,41,43)(H,45,46)/b7-5-,12-11-,15-14-,18-17-,21-20-,24-23- |
| InChIKey | KKFUURKKYNZGOH-RLESYFSLSA-N |
| XLogP | 9.93 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.96 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|