C43H76NO10P — CID 165242995
3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid (PubChem CID 165242995) has the molecular formula C43H76NO10P and a molecular weight of 798.05 g/mol. Its IUPAC name is 3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165242995 |
| Molecular Formula | C43H76NO10P |
| Molecular Weight | 798.05 g/mol |
| Exact Mass | 797.52 |
| IUPAC Name | 3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCCCC)C(=O)O |
| InChI | InChI=1S/C43H76NO10P/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-26-28-30-32-34-41(46)44-40(43(48)49)38-54-55(50,51)53-37-39(45)36-52-42(47)35-33-31-29-27-25-23-18-16-14-12-10-8-6-4-2/h5,7,11,13,16-19,39-40,45H,3-4,6,8-10,12,14-15,20-38H2,1-2H3,(H,44,46)(H,48,49)(H,50,51)/b7-5-,13-11-,18-16-,19-17- |
| InChIKey | KNQLUMGFUPVZDX-PPEBMUNXSA-N |
| XLogP | 10.61 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.05 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|