C43H70NO8P — CID 165265091
[2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoate (PubChem CID 165265091) has the molecular formula C43H70NO8P and a molecular weight of 760.01 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoate |
|---|---|
| PubChem CID | 165265091 |
| Molecular Formula | C43H70NO8P |
| Molecular Weight | 760.01 g/mol |
| Exact Mass | 759.48 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C43H70NO8P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-32-34-36-43(47)50-39-41(45)40-52-53(48,49)51-38-37-44-42(46)35-33-31-29-27-25-14-12-10-8-6-4-2/h5,7,10-13,16-17,19-20,22-23,26,28,32,34,41,45H,3-4,6,8-9,14-15,18,21,24-25,27,29-31,33,35-40H2,1-2H3,(H,44,46)(H,48,49)/b7-5-,12-10-,13-11-,17-16-,20-19-,23-22-,28-26-,34-32- |
| InChIKey | NXIPWSBCUOORSR-ODFCBYMCSA-N |
| XLogP | 10.65 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.01 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|