About L-Histidinol
L-Histidinol (PubChem CID 165271) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-imidazol-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | L-Histidinol |
| PubChem CID | 165271 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propan-1-ol |
| SMILES | C1=C(NC=N1)C[C@@H](CO)N |
| InChI | InChI=1S/C6H11N3O/c7-5(3-10)1-6-2-8-4-9-6/h2,4-5,10H,1,3,7H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | ZQISRDCJNBUVMM-YFKPBYRVSA-N |
| XLogP | -1.20 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | 99 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze L-Histidinol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of L-Histidinol?
The IUPAC name of L-Histidinol (CID 165271) is (2S)-2-amino-3-(1H-imidazol-5-yl)propan-1-ol.
What is the SMILES notation for L-Histidinol?
The canonical SMILES for L-Histidinol is C1=C(NC=N1)C[C@@H](CO)N.
What is the InChIKey of L-Histidinol?
The InChIKey is ZQISRDCJNBUVMM-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11N3O/c7-5(3-10)1-6-2-8-4-9-6/h2,4-5,10H,1,3,7H2,(H,8,9)/t5-/m0/s1.
What are the key properties of L-Histidinol?
L-Histidinol has a molecular weight of 141.17 g/mol, XLogP of -1.20, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for L-Histidinol is sourced from PubChem (CID 165271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).