About 1H-Imidazole-5-propanoic acid
1H-Imidazole-5-propanoic acid (PubChem CID 70630) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 1H-Imidazole-5-propanoic acid |
| PubChem CID | 70630 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | C1=C(NC=N1)CCC(=O)O |
| InChI | InChI=1S/C6H8N2O2/c9-6(10)2-1-5-3-7-4-8-5/h3-4H,1-2H2,(H,7,8)(H,9,10) |
| InChIKey | ZCKYOWGFRHAZIQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | 127 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-Imidazole-5-propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-Imidazole-5-propanoic acid?
The IUPAC name of 1H-Imidazole-5-propanoic acid (CID 70630) is 3-(1H-imidazol-5-yl)propanoic acid.
What is the SMILES notation for 1H-Imidazole-5-propanoic acid?
The canonical SMILES for 1H-Imidazole-5-propanoic acid is C1=C(NC=N1)CCC(=O)O.
What is the InChIKey of 1H-Imidazole-5-propanoic acid?
The InChIKey is ZCKYOWGFRHAZIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c9-6(10)2-1-5-3-7-4-8-5/h3-4H,1-2H2,(H,7,8)(H,9,10).
What are the key properties of 1H-Imidazole-5-propanoic acid?
1H-Imidazole-5-propanoic acid has a molecular weight of 140.14 g/mol, XLogP of -0.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-Imidazole-5-propanoic acid is sourced from PubChem (CID 70630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).