About Histidine Monohydrochloride
Histidine Monohydrochloride (PubChem CID 66091) has the molecular formula C6H10ClN3O2
and a molecular weight of 191.61 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | Histidine Monohydrochloride |
| PubChem CID | 66091 |
| Molecular Formula | C6H10ClN3O2 |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)N.Cl |
| InChI | InChI=1S/C6H9N3O2.ClH/c7-5(6(10)11)1-4-2-8-3-9-4;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H/t5-;/m0./s1 |
| InChIKey | QZNNVYOVQUKYSC-JEDNCBNOSA-N |
| XLogP | — |
| TPSA | 92.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 151 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Histidine Monohydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Histidine Monohydrochloride?
The IUPAC name of Histidine Monohydrochloride (CID 66091) is (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride.
What is the SMILES notation for Histidine Monohydrochloride?
The canonical SMILES for Histidine Monohydrochloride is C1=C(NC=N1)C[C@@H](C(=O)O)N.Cl.
What is the InChIKey of Histidine Monohydrochloride?
The InChIKey is QZNNVYOVQUKYSC-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H9N3O2.ClH/c7-5(6(10)11)1-4-2-8-3-9-4;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H/t5-;/m0./s1.
What are the key properties of Histidine Monohydrochloride?
Histidine Monohydrochloride has a molecular weight of 191.61 g/mol, XLogP of not available, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Histidine Monohydrochloride is sourced from PubChem (CID 66091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).