About D-Histidine
D-Histidine (PubChem CID 71083) has the molecular formula C6H9N3O2
and a molecular weight of 155.15 g/mol. Its IUPAC name is (2R)-2-amino-3-(1H-imidazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | D-Histidine |
| PubChem CID | 71083 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (2R)-2-amino-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | C1=C(NC=N1)C[C@H](C(=O)O)N |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m1/s1 |
| InChIKey | HNDVDQJCIGZPNO-RXMQYKEDSA-N |
| XLogP | -3.20 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 151 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze D-Histidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of D-Histidine?
The IUPAC name of D-Histidine (CID 71083) is (2R)-2-amino-3-(1H-imidazol-5-yl)propanoic acid.
What is the SMILES notation for D-Histidine?
The canonical SMILES for D-Histidine is C1=C(NC=N1)C[C@H](C(=O)O)N.
What is the InChIKey of D-Histidine?
The InChIKey is HNDVDQJCIGZPNO-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m1/s1.
What are the key properties of D-Histidine?
D-Histidine has a molecular weight of 155.15 g/mol, XLogP of -3.20, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for D-Histidine is sourced from PubChem (CID 71083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).