About Polaprezinc
Polaprezinc (PubChem CID 9817450) has the molecular formula C9H12N4O3Zn
and a molecular weight of 289.60 g/mol. Its IUPAC name is zinc (2S)-2-(3-aminopropanoylamino)-3-imidazol-1-id-4-ylpropanoate.
Molecular Properties
| Compound Name | Polaprezinc |
| PubChem CID | 9817450 |
| Molecular Formula | C9H12N4O3Zn |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | zinc (2S)-2-(3-aminopropanoylamino)-3-imidazol-1-id-4-ylpropanoate |
| SMILES | C1=C(N=C[N-]1)C[C@@H](C(=O)[O-])NC(=O)CCN.[Zn+2] |
| InChI | InChI=1S/C9H14N4O3.Zn/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6;/h4-5,7H,1-3,10H2,(H3,11,12,13,14,15,16);/q;+2/p-2/t7-;/m0./s1 |
| InChIKey | IGXZLYMCFZHNKW-FJXQXJEOSA-L |
| XLogP | — |
| TPSA | 109.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | 254 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Polaprezinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Polaprezinc?
The IUPAC name of Polaprezinc (CID 9817450) is zinc (2S)-2-(3-aminopropanoylamino)-3-imidazol-1-id-4-ylpropanoate.
What is the SMILES notation for Polaprezinc?
The canonical SMILES for Polaprezinc is C1=C(N=C[N-]1)C[C@@H](C(=O)[O-])NC(=O)CCN.[Zn+2].
What is the InChIKey of Polaprezinc?
The InChIKey is IGXZLYMCFZHNKW-FJXQXJEOSA-L. The full InChI is InChI=1S/C9H14N4O3.Zn/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6;/h4-5,7H,1-3,10H2,(H3,11,12,13,14,15,16);/q;+2/p-2/t7-;/m0./s1.
What are the key properties of Polaprezinc?
Polaprezinc has a molecular weight of 289.60 g/mol, XLogP of not available, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Polaprezinc is sourced from PubChem (CID 9817450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).