About Carnosine
Carnosine (PubChem CID 439224) has the molecular formula C9H14N4O3
and a molecular weight of 226.23 g/mol. Its IUPAC name is (2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | Carnosine |
| PubChem CID | 439224 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)CCN |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
| XLogP | -4.00 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | 259 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Carnosine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Carnosine?
The IUPAC name of Carnosine (CID 439224) is (2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid.
What is the SMILES notation for Carnosine?
The canonical SMILES for Carnosine is C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)CCN.
What is the InChIKey of Carnosine?
The InChIKey is CQOVPNPJLQNMDC-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1.
What are the key properties of Carnosine?
Carnosine has a molecular weight of 226.23 g/mol, XLogP of -4.00, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Carnosine is sourced from PubChem (CID 439224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).