About 1-Methyl-L-histidine
1-Methyl-L-histidine (PubChem CID 92105) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 1-Methyl-L-histidine |
| PubChem CID | 92105 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoic acid |
| SMILES | CN1C=C(N=C1)C[C@@H](C(=O)O)N |
| InChI | InChI=1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | BRMWTNUJHUMWMS-LURJTMIESA-N |
| XLogP | -3.30 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 174 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-Methyl-L-histidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Methyl-L-histidine?
The IUPAC name of 1-Methyl-L-histidine (CID 92105) is (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoic acid.
What is the SMILES notation for 1-Methyl-L-histidine?
The canonical SMILES for 1-Methyl-L-histidine is CN1C=C(N=C1)C[C@@H](C(=O)O)N.
What is the InChIKey of 1-Methyl-L-histidine?
The InChIKey is BRMWTNUJHUMWMS-LURJTMIESA-N. The full InChI is InChI=1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1.
What are the key properties of 1-Methyl-L-histidine?
1-Methyl-L-histidine has a molecular weight of 169.18 g/mol, XLogP of -3.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Methyl-L-histidine is sourced from PubChem (CID 92105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).