C34H67N2O6P — CID 165287994
2-aminoethyl [(E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxypentadec-4-enyl] hydrogen phosphate (PubChem CID 165287994) has the molecular formula C34H67N2O6P and a molecular weight of 630.89 g/mol. Its IUPAC name is 2-aminoethyl [(E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxypentadec-4-enyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxypentadec-4-enyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165287994 |
| Molecular Formula | C34H67N2O6P |
| Molecular Weight | 630.89 g/mol |
| Exact Mass | 630.47 |
| IUPAC Name | 2-aminoethyl [(E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxypentadec-4-enyl] hydrogen phosphate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C34H67N2O6P/c1-3-5-7-9-11-13-15-16-17-18-20-22-24-26-28-34(38)36-32(31-42-43(39,40)41-30-29-35)33(37)27-25-23-21-19-14-12-10-8-6-4-2/h15-16,25,27,32-33,37H,3-14,17-24,26,28-31,35H2,1-2H3,(H,36,38)(H,39,40)/b16-15-,27-25+ |
| InChIKey | RKGQHAGXLGQEEK-TYNLAMJVSA-N |
| XLogP | 8.66 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.89 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|