C31H61N2O6P — CID 165302023
2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxytridec-4-enyl] hydrogen phosphate (PubChem CID 165302023) has the molecular formula C31H61N2O6P and a molecular weight of 588.81 g/mol. Its IUPAC name is 2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxytridec-4-enyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxytridec-4-enyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165302023 |
| Molecular Formula | C31H61N2O6P |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.43 |
| IUPAC Name | 2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxytridec-4-enyl] hydrogen phosphate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CCCCCCCC |
| InChI | InChI=1S/C31H61N2O6P/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-31(35)33-29(28-39-40(36,37)38-27-26-32)30(34)24-22-20-18-12-10-8-6-4-2/h13-14,22,24,29-30,34H,3-12,15-21,23,25-28,32H2,1-2H3,(H,33,35)(H,36,37)/b14-13-,24-22+ |
| InChIKey | UHHNFZCFJOCVAF-AHRDZSMFSA-N |
| XLogP | 7.49 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|