C30H59N2O6P — CID 165319049
2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate (PubChem CID 165319049) has the molecular formula C30H59N2O6P and a molecular weight of 574.78 g/mol. Its IUPAC name is 2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165319049 |
| Molecular Formula | C30H59N2O6P |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.41 |
| IUPAC Name | 2-aminoethyl [(E)-2-[[(Z)-hexadec-9-enoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CCCCCCC |
| InChI | InChI=1S/C30H59N2O6P/c1-3-5-7-9-11-12-13-14-15-16-18-20-22-24-30(34)32-28(27-38-39(35,36)37-26-25-31)29(33)23-21-19-17-10-8-6-4-2/h12-13,21,23,28-29,33H,3-11,14-20,22,24-27,31H2,1-2H3,(H,32,34)(H,35,36)/b13-12-,23-21+ |
| InChIKey | WXOORXYONRSWTF-YGJABYTASA-N |
| XLogP | 7.10 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|