C48H82NO8P — CID 165292593
[3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-heptadec-9-enoate (PubChem CID 165292593) has the molecular formula C48H82NO8P and a molecular weight of 832.16 g/mol. Its IUPAC name is [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-heptadec-9-enoate.
| Compound Name | [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 165292593 |
| Molecular Formula | C48H82NO8P |
| Molecular Weight | 832.16 g/mol |
| Exact Mass | 831.58 |
| IUPAC Name | [3-[2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-heptadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCCCC |
| InChI | InChI=1S/C48H82NO8P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-24-25-26-27-28-30-32-34-36-38-40-47(51)49-42-43-56-58(53,54)57-45-46(50)44-55-48(52)41-39-37-35-33-31-29-18-16-14-12-10-8-6-4-2/h5,7,11,13,16-19,21-22,24-25,27-28,46,50H,3-4,6,8-10,12,14-15,20,23,26,29-45H2,1-2H3,(H,49,51)(H,53,54)/b7-5-,13-11-,18-16-,19-17-,22-21-,25-24-,28-27- |
| InChIKey | SCIMIKBYBXVSAL-ZUDKBLOOSA-N |
| XLogP | 12.83 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.16 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|