C44H72NO10P — CID 165300628
2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]-3-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 165300628) has the molecular formula C44H72NO10P and a molecular weight of 806.03 g/mol. Its IUPAC name is 2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]-3-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]-3-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165300628 |
| Molecular Formula | C44H72NO10P |
| Molecular Weight | 806.03 g/mol |
| Exact Mass | 805.49 |
| IUPAC Name | 2-[[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]amino]-3-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OCC(O)COP(=O)(O)OCC(NC(=O)CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)C(=O)O |
| InChI | InChI=1S/C44H72NO10P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-25-27-29-31-33-35-42(47)45-41(44(49)50)39-55-56(51,52)54-38-40(46)37-53-43(48)36-34-32-30-28-26-23-16-14-12-10-8-6-4-2/h6,8,11-14,17-18,20-21,23-26,40-41,46H,3-5,7,9-10,15-16,19,22,27-39H2,1-2H3,(H,45,47)(H,49,50)(H,51,52)/b8-6-,13-11-,14-12-,18-17-,21-20-,25-24-,26-23- |
| InChIKey | UBXLQJWIHDGEQG-NZUQPFHXSA-N |
| XLogP | 10.33 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.03 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|