C27H25NO6 — CID 16533996
[2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 16533996) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 16533996 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1ccccc1/C=C(/C(=O)OCC(=O)NC(C)c1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C27H25NO6/c1-18(20-12-13-24-25(15-20)34-17-33-24)28-26(29)16-32-27(30)22(19-8-4-3-5-9-19)14-21-10-6-7-11-23(21)31-2/h3-15,18H,16-17H2,1-2H3,(H,28,29)/b22-14+ |
| InChIKey | URTDBLFKZMOQNI-HYARGMPZSA-N |
| XLogP | 4.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|