C10H16NO5PS2 — CID 165340894
4-dimethoxyphosphinothioyloxy-N,2-dimethylbenzenesulfonamide (PubChem CID 165340894) has the molecular formula C10H16NO5PS2 and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-dimethoxyphosphinothioyloxy-N,2-dimethylbenzenesulfonamide.
| Compound Name | 4-dimethoxyphosphinothioyloxy-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 165340894 |
| Molecular Formula | C10H16NO5PS2 |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 4-dimethoxyphosphinothioyloxy-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(OP(=S)(OC)OC)cc1C |
| InChI | InChI=1S/C10H16NO5PS2/c1-8-7-9(16-17(18,14-3)15-4)5-6-10(8)19(12,13)11-2/h5-7,11H,1-4H3 |
| InChIKey | HMIOHDFYYUOWRL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|