C10H15O3PS — CID 23525793
(3,4-dimethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane (PubChem CID 23525793) has the molecular formula C10H15O3PS and a molecular weight of 246.27 g/mol. Its IUPAC name is (3,4-dimethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | (3,4-dimethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23525793 |
| Molecular Formula | C10H15O3PS |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (3,4-dimethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane |
| SMILES | COP(=S)(OC)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C10H15O3PS/c1-8-5-6-10(7-9(8)2)13-14(15,11-3)12-4/h5-7H,1-4H3 |
| InChIKey | VFPIDMNBRBLUSR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|