C15H17O3P — CID 87625044
(3,4-dimethylphenoxy)-(2-methylphenyl)phosphinic acid (PubChem CID 87625044) has the molecular formula C15H17O3P and a molecular weight of 276.27 g/mol. Its IUPAC name is (3,4-dimethylphenoxy)-(2-methylphenyl)phosphinic acid.
| Compound Name | (3,4-dimethylphenoxy)-(2-methylphenyl)phosphinic acid |
|---|---|
| PubChem CID | 87625044 |
| Molecular Formula | C15H17O3P |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (3,4-dimethylphenoxy)-(2-methylphenyl)phosphinic acid |
| SMILES | Cc1ccc(OP(=O)(O)c2ccccc2C)cc1C |
| InChI | InChI=1S/C15H17O3P/c1-11-8-9-14(10-13(11)3)18-19(16,17)15-7-5-4-6-12(15)2/h4-10H,1-3H3,(H,16,17) |
| InChIKey | ZHBHAJCQCIEYKX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|