C16H18ClO3P — CID 102057999
4-[chloro-(3,5-dimethylphenoxy)phosphoryl]oxy-1,2-dimethylbenzene (PubChem CID 102057999) has the molecular formula C16H18ClO3P and a molecular weight of 324.74 g/mol. Its IUPAC name is 4-[chloro-(3,5-dimethylphenoxy)phosphoryl]oxy-1,2-dimethylbenzene.
| Compound Name | 4-[chloro-(3,5-dimethylphenoxy)phosphoryl]oxy-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 102057999 |
| Molecular Formula | C16H18ClO3P |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-[chloro-(3,5-dimethylphenoxy)phosphoryl]oxy-1,2-dimethylbenzene |
| SMILES | Cc1cc(C)cc(OP(=O)(Cl)Oc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C16H18ClO3P/c1-11-7-12(2)9-16(8-11)20-21(17,18)19-15-6-5-13(3)14(4)10-15/h5-10H,1-4H3 |
| InChIKey | LLPLRUFELKNMFF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|