C17H22NO2P — CID 11859810
N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline (PubChem CID 11859810) has the molecular formula C17H22NO2P and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline.
| Compound Name | N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 11859810 |
| Molecular Formula | C17H22NO2P |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(O[P@@](C)(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C17H22NO2P/c1-12-6-7-15(4)17(11-12)18-21(5,19)20-16-9-13(2)8-14(3)10-16/h6-11H,1-5H3,(H,18,19)/t21-/m1/s1 |
| InChIKey | BQLIRMYYVUOBKZ-OAQYLSRUSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|