About N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline
N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline (PubChem CID 11859810) has the molecular formula C17H22NO2P
and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline.
Molecular Properties
| Compound Name | N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline |
| PubChem CID | 11859810 |
| Molecular Formula | C17H22NO2P |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(O[P@@](C)(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C17H22NO2P/c1-12-6-7-15(4)17(11-12)18-21(5,19)20-16-9-13(2)8-14(3)10-16/h6-11H,1-5H3,(H,18,19)/t21-/m1/s1 |
| InChIKey | BQLIRMYYVUOBKZ-OAQYLSRUSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline?
The IUPAC name of N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline (CID 11859810) is N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline.
What is the SMILES notation for N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline?
The canonical SMILES for N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline is Cc1cc(C)cc(O[P@@](C)(=O)Nc2cc(C)ccc2C)c1.
What is the InChIKey of N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline?
The InChIKey is BQLIRMYYVUOBKZ-OAQYLSRUSA-N. The full InChI is InChI=1S/C17H22NO2P/c1-12-6-7-15(4)17(11-12)18-21(5,19)20-16-9-13(2)8-14(3)10-16/h6-11H,1-5H3,(H,18,19)/t21-/m1/s1.
What are the key properties of N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline?
N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline has a molecular weight of 303.34 g/mol, XLogP of 5.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2,5-dimethylaniline is sourced from PubChem (CID 11859810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).