C15H19NO — CID 165343330
(2S,3aR)-2-[(E)-2-phenylethenyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine (PubChem CID 165343330) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (2S,3aR)-2-[(E)-2-phenylethenyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine.
| Compound Name | (2S,3aR)-2-[(E)-2-phenylethenyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine |
|---|---|
| PubChem CID | 165343330 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2S,3aR)-2-[(E)-2-phenylethenyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine |
| SMILES | C(=C/[C@@H]1C[C@H]2CCCCN2O1)\c1ccccc1 |
| InChI | InChI=1S/C15H19NO/c1-2-6-13(7-3-1)9-10-15-12-14-8-4-5-11-16(14)17-15/h1-3,6-7,9-10,14-15H,4-5,8,11-12H2/b10-9+/t14-,15-/m1/s1 |
| InChIKey | OLTLRXSNXIXKLR-SXKCSBRWSA-N |
| XLogP | 3.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |