C11H7Cl2N3OS2 — CID 165344518
2-[[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl thiocyanate (PubChem CID 165344518) has the molecular formula C11H7Cl2N3OS2 and a molecular weight of 332.24 g/mol. Its IUPAC name is 2-[[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl thiocyanate.
| Compound Name | 2-[[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl thiocyanate |
|---|---|
| PubChem CID | 165344518 |
| Molecular Formula | C11H7Cl2N3OS2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 2-[[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl thiocyanate |
| SMILES | N#CSCCSc1nnc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C11H7Cl2N3OS2/c12-8-3-7(4-9(13)5-8)10-15-16-11(17-10)19-2-1-18-6-14/h3-5H,1-2H2 |
| InChIKey | CMJIVTAQMZPUHS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|