C16H19F2NO3 — CID 165345301
(4R)-4-benzyl-3-(5,5-difluorohexanoyl)-1,3-oxazolidin-2-one (PubChem CID 165345301) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is (4R)-4-benzyl-3-(5,5-difluorohexanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-(5,5-difluorohexanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 165345301 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (4R)-4-benzyl-3-(5,5-difluorohexanoyl)-1,3-oxazolidin-2-one |
| SMILES | CC(F)(F)CCCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H19F2NO3/c1-16(17,18)9-5-8-14(20)19-13(11-22-15(19)21)10-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3/t13-/m1/s1 |
| InChIKey | KOOGTWLWAZUMQE-CYBMUJFWSA-N |
| XLogP | 3.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |