C12H14NO2S+ — CID 165346784
1-acetyl-3-phenyl-1,3-thiazinan-1-ium-4-one (PubChem CID 165346784) has the molecular formula C12H14NO2S+ and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-acetyl-3-phenyl-1,3-thiazinan-1-ium-4-one.
| Compound Name | 1-acetyl-3-phenyl-1,3-thiazinan-1-ium-4-one |
|---|---|
| PubChem CID | 165346784 |
| Molecular Formula | C12H14NO2S+ |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-acetyl-3-phenyl-1,3-thiazinan-1-ium-4-one |
| SMILES | CC(=O)[S+]1CCC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C12H14NO2S/c1-10(14)16-8-7-12(15)13(9-16)11-5-3-2-4-6-11/h2-6H,7-9H2,1H3/q+1 |
| InChIKey | OOPSPAIEIFGIEY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|