(2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate

C6H6ClNO4 — CID 165347051

IUPAC(2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate
SMILESO=C(Cl)OCN1C(=O)CCC1=O
InChIInChI=1S/C6H6ClNO4/c7-6(11)12-3-8-4(9)1-2-5(8)10/h1-3H2
InChIKeyPMIYZRJXCVKRFE-UHFFFAOYSA-N
MW191.57 g/mol
LogP0.47
Rot. Bonds2

About (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate

(2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate (PubChem CID 165347051) has the molecular formula C6H6ClNO4 and a molecular weight of 191.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate.

Molecular Properties

Compound Name(2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate
PubChem CID165347051
Molecular FormulaC6H6ClNO4
Molecular Weight191.57 g/mol
Exact Mass191.00
IUPAC Name(2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate
SMILESO=C(Cl)OCN1C(=O)CCC1=O
InChIInChI=1S/C6H6ClNO4/c7-6(11)12-3-8-4(9)1-2-5(8)10/h1-3H2
InChIKeyPMIYZRJXCVKRFE-UHFFFAOYSA-N
XLogP0.47
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.57
LogP ≤ 50.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate (CID 165347051) is (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate is O=C(Cl)OCN1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate?
The InChIKey is PMIYZRJXCVKRFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO4/c7-6(11)12-3-8-4(9)1-2-5(8)10/h1-3H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate?
(2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate has a molecular weight of 191.57 g/mol, XLogP of 0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate is sourced from PubChem (CID 165347051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).