C6H6ClNO4 — CID 165347051
(2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate (PubChem CID 165347051) has the molecular formula C6H6ClNO4 and a molecular weight of 191.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate |
|---|---|
| PubChem CID | 165347051 |
| Molecular Formula | C6H6ClNO4 |
| Molecular Weight | 191.57 g/mol |
| Exact Mass | 191.00 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)methyl carbonochloridate |
| SMILES | O=C(Cl)OCN1C(=O)CCC1=O |
| InChI | InChI=1S/C6H6ClNO4/c7-6(11)12-3-8-4(9)1-2-5(8)10/h1-3H2 |
| InChIKey | PMIYZRJXCVKRFE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.57 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|