C15H5F5N2O2S — CID 165350801
(2,3,4,5,6-pentafluorophenyl) 2-thiophen-2-ylpyrimidine-5-carboxylate (PubChem CID 165350801) has the molecular formula C15H5F5N2O2S and a molecular weight of 372.27 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-thiophen-2-ylpyrimidine-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-thiophen-2-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 165350801 |
| Molecular Formula | C15H5F5N2O2S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-thiophen-2-ylpyrimidine-5-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cnc(-c2cccs2)nc1 |
| InChI | InChI=1S/C15H5F5N2O2S/c16-8-9(17)11(19)13(12(20)10(8)18)24-15(23)6-4-21-14(22-5-6)7-2-1-3-25-7/h1-5H |
| InChIKey | PWYMECVBJSZNFT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|