C13H16N4O2S — CID 165350812
3-(3-nitrophenyl)-4-pentyl-1H-1,2,4-triazole-5-thione (PubChem CID 165350812) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-4-pentyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(3-nitrophenyl)-4-pentyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 165350812 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-(3-nitrophenyl)-4-pentyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCCn1c(-c2cccc([N+](=O)[O-])c2)n[nH]c1=S |
| InChI | InChI=1S/C13H16N4O2S/c1-2-3-4-8-16-12(14-15-13(16)20)10-6-5-7-11(9-10)17(18)19/h5-7,9H,2-4,8H2,1H3,(H,15,20) |
| InChIKey | NJRYGFCFYZYPQE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|