C14H14N6O2S — CID 165411683
3-[1-ethyl-3-(3-nitrophenyl)pyrazol-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 165411683) has the molecular formula C14H14N6O2S and a molecular weight of 330.37 g/mol. Its IUPAC name is 3-[1-ethyl-3-(3-nitrophenyl)pyrazol-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[1-ethyl-3-(3-nitrophenyl)pyrazol-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 165411683 |
| Molecular Formula | C14H14N6O2S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-[1-ethyl-3-(3-nitrophenyl)pyrazol-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1cc(-c2n[nH]c(=S)n2C)c(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H14N6O2S/c1-3-19-8-11(13-15-16-14(23)18(13)2)12(17-19)9-5-4-6-10(7-9)20(21)22/h4-8H,3H2,1-2H3,(H,16,23) |
| InChIKey | LUYSSKUZSLRYMM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|