C16H11N5O2S — CID 165411409
3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4-(3-nitrophenyl)benzonitrile (PubChem CID 165411409) has the molecular formula C16H11N5O2S and a molecular weight of 337.36 g/mol. Its IUPAC name is 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4-(3-nitrophenyl)benzonitrile.
| Compound Name | 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4-(3-nitrophenyl)benzonitrile |
|---|---|
| PubChem CID | 165411409 |
| Molecular Formula | C16H11N5O2S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4-(3-nitrophenyl)benzonitrile |
| SMILES | Cn1c(-c2cc(C#N)ccc2-c2cccc([N+](=O)[O-])c2)n[nH]c1=S |
| InChI | InChI=1S/C16H11N5O2S/c1-20-15(18-19-16(20)24)14-7-10(9-17)5-6-13(14)11-3-2-4-12(8-11)21(22)23/h2-8H,1H3,(H,19,24) |
| InChIKey | YZPYIUBKUVAMMN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|