C9H7N5O4S — CID 18408630
3-(2,4-dinitrophenyl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 18408630) has the molecular formula C9H7N5O4S and a molecular weight of 281.25 g/mol. Its IUPAC name is 3-(2,4-dinitrophenyl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,4-dinitrophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 18408630 |
| Molecular Formula | C9H7N5O4S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 3-(2,4-dinitrophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n[nH]c1=S |
| InChI | InChI=1S/C9H7N5O4S/c1-12-8(10-11-9(12)19)6-3-2-5(13(15)16)4-7(6)14(17)18/h2-4H,1H3,(H,11,19) |
| InChIKey | WRTGGJWRWSPFQB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|