C17H22FN — CID 165361706
1-[2-(3-fluorophenyl)-2-bicyclo[2.2.1]heptanyl]pyrrolidine (PubChem CID 165361706) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)-2-bicyclo[2.2.1]heptanyl]pyrrolidine.
| Compound Name | 1-[2-(3-fluorophenyl)-2-bicyclo[2.2.1]heptanyl]pyrrolidine |
|---|---|
| PubChem CID | 165361706 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-[2-(3-fluorophenyl)-2-bicyclo[2.2.1]heptanyl]pyrrolidine |
| SMILES | Fc1cccc(C2(N3CCCC3)CC3CCC2C3)c1 |
| InChI | InChI=1S/C17H22FN/c18-16-5-3-4-14(11-16)17(19-8-1-2-9-19)12-13-6-7-15(17)10-13/h3-5,11,13,15H,1-2,6-10,12H2 |
| InChIKey | MRVOPPYPUOXGRO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |