C20H14O3 — CID 165363898
(1S,19R)-20-oxahexacyclo[10.8.1.01,19.02,11.05,10.016,21]henicosa-2(11),3,5,7,9,12(21),13,15-octaene-17,18-diol (PubChem CID 165363898) has the molecular formula C20H14O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is (1S,19R)-20-oxahexacyclo[10.8.1.01,19.02,11.05,10.016,21]henicosa-2(11),3,5,7,9,12(21),13,15-octaene-17,18-diol.
| Compound Name | (1S,19R)-20-oxahexacyclo[10.8.1.01,19.02,11.05,10.016,21]henicosa-2(11),3,5,7,9,12(21),13,15-octaene-17,18-diol |
|---|---|
| PubChem CID | 165363898 |
| Molecular Formula | C20H14O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (1S,19R)-20-oxahexacyclo[10.8.1.01,19.02,11.05,10.016,21]henicosa-2(11),3,5,7,9,12(21),13,15-octaene-17,18-diol |
| SMILES | OC1c2cccc3c2[C@@]2(O[C@@H]2C1O)c1ccc2ccccc2c1-3 |
| InChI | InChI=1S/C20H14O3/c21-17-13-7-3-6-12-15-11-5-2-1-4-10(11)8-9-14(15)20(16(12)13)19(23-20)18(17)22/h1-9,17-19,21-22H/t17?,18?,19-,20+/m1/s1 |
| InChIKey | BZFMVISIXFGYOM-TUNPWDSISA-N |
| XLogP | 2.87 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|