C19H14O3 — CID 10469465
(1R,3S,4S,5R)-2-oxahexacyclo[15.2.1.01,3.06,19.09,18.010,15]icosa-6(19),7,9(18),10,12,14,16-heptaene-4,5-diol (PubChem CID 10469465) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is (1R,3S,4S,5R)-2-oxahexacyclo[15.2.1.01,3.06,19.09,18.010,15]icosa-6(19),7,9(18),10,12,14,16-heptaene-4,5-diol.
| Compound Name | (1R,3S,4S,5R)-2-oxahexacyclo[15.2.1.01,3.06,19.09,18.010,15]icosa-6(19),7,9(18),10,12,14,16-heptaene-4,5-diol |
|---|---|
| PubChem CID | 10469465 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1R,3S,4S,5R)-2-oxahexacyclo[15.2.1.01,3.06,19.09,18.010,15]icosa-6(19),7,9(18),10,12,14,16-heptaene-4,5-diol |
| SMILES | O[C@H]1[C@H](O)c2ccc3c4c(cc5ccccc53)C[C@@]3(O[C@@H]13)c24 |
| InChI | InChI=1S/C19H14O3/c20-16-13-6-5-12-11-4-2-1-3-9(11)7-10-8-19(15(13)14(10)12)18(22-19)17(16)21/h1-7,16-18,20-21H,8H2/t16-,17+,18+,19-/m1/s1 |
| InChIKey | ZKGKPCDEHOENSJ-YDZRNGNQSA-N |
| XLogP | 2.55 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|