C12H22F5N2O3S+ — CID 165364754
trimethyl-[3-[[2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetyl]amino]propyl]azanium (PubChem CID 165364754) has the molecular formula C12H22F5N2O3S+ and a molecular weight of 369.38 g/mol. Its IUPAC name is trimethyl-[3-[[2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetyl]amino]propyl]azanium.
| Compound Name | trimethyl-[3-[[2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 165364754 |
| Molecular Formula | C12H22F5N2O3S+ |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | trimethyl-[3-[[2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetyl]amino]propyl]azanium |
| SMILES | C[N+](C)(C)CCCNC(=O)CS(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H21F5N2O3S/c1-19(2,3)7-4-6-18-10(20)9-23(21,22)8-5-11(13,14)12(15,16)17/h4-9H2,1-3H3/p+1 |
| InChIKey | YPBODPXQAHZKCT-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|