C40H24F6N4O6 — CID 165365905
4-[4-[5-[2-[2-(4-aminophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 165365905) has the molecular formula C40H24F6N4O6 and a molecular weight of 770.64 g/mol. Its IUPAC name is 4-[4-[5-[2-[2-(4-aminophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[4-[5-[2-[2-(4-aminophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 165365905 |
| Molecular Formula | C40H24F6N4O6 |
| Molecular Weight | 770.64 g/mol |
| Exact Mass | 770.16 |
| IUPAC Name | 4-[4-[5-[2-[2-(4-aminophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Nc1ccc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4ccc(N6C(=O)C7C8C=CC(C8)C7C6=O)cc4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)cc1 |
| InChI | InChI=1S/C40H24F6N4O6/c41-39(42,43)38(40(44,45)46,20-3-13-26-28(16-20)34(53)48(32(26)51)23-7-5-22(47)6-8-23)21-4-14-27-29(17-21)35(54)49(33(27)52)24-9-11-25(12-10-24)50-36(55)30-18-1-2-19(15-18)31(30)37(50)56/h1-14,16-19,30-31H,15,47H2 |
| InChIKey | YKPOSDBAOVPGLP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|