C18H18BF3N2O2 — CID 165371571
9-(difluoromethyl)-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-b]indole (PubChem CID 165371571) has the molecular formula C18H18BF3N2O2 and a molecular weight of 362.16 g/mol. Its IUPAC name is 9-(difluoromethyl)-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-b]indole.
| Compound Name | 9-(difluoromethyl)-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 165371571 |
| Molecular Formula | C18H18BF3N2O2 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 9-(difluoromethyl)-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-b]indole |
| SMILES | CC1(C)OB(c2ccc3c4cc(F)cnc4n(C(F)F)c3c2)OC1(C)C |
| InChI | InChI=1S/C18H18BF3N2O2/c1-17(2)18(3,4)26-19(25-17)10-5-6-12-13-8-11(20)9-23-15(13)24(16(21)22)14(12)7-10/h5-9,16H,1-4H3 |
| InChIKey | FNTHRGTXYWCLJC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|