C15H20BFN2O2 — CID 91588319
1-ethyl-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 91588319) has the molecular formula C15H20BFN2O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-ethyl-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 91588319 |
| Molecular Formula | C15H20BFN2O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-ethyl-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | CCn1cc(B2OC(C)(C)C(C)(C)O2)c2cc(F)cnc21 |
| InChI | InChI=1S/C15H20BFN2O2/c1-6-19-9-12(11-7-10(17)8-18-13(11)19)16-20-14(2,3)15(4,5)21-16/h7-9H,6H2,1-5H3 |
| InChIKey | CGICSYJUSDFZAM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|