C25H22F3N7O — CID 165374322
2-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-1-[4-(1,2,4-triazol-4-yl)-2-pyridinyl]ethanone (PubChem CID 165374322) has the molecular formula C25H22F3N7O and a molecular weight of 493.49 g/mol. Its IUPAC name is 2-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-1-[4-(1,2,4-triazol-4-yl)-2-pyridinyl]ethanone.
| Compound Name | 2-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-1-[4-(1,2,4-triazol-4-yl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 165374322 |
| Molecular Formula | C25H22F3N7O |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-1-[4-(1,2,4-triazol-4-yl)-2-pyridinyl]ethanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)CC1CCCC2N1CC(=O)c1cc(-n2cnnc2)ccn1 |
| InChI | InChI=1S/C25H22F3N7O/c1-33-25(14-7-18(26)23(28)19(27)8-14)17-9-16-3-2-4-21(24(17)32-33)35(16)11-22(36)20-10-15(5-6-29-20)34-12-30-31-13-34/h5-8,10,12-13,16,21H,2-4,9,11H2,1H3 |
| InChIKey | UQVDZMQECSFUFE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|