C24H22F3N7O — CID 170125935
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[5-(1,2,4-triazol-4-yl)-3-pyridinyl]methanol (PubChem CID 170125935) has the molecular formula C24H22F3N7O and a molecular weight of 481.48 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[5-(1,2,4-triazol-4-yl)-3-pyridinyl]methanol.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[5-(1,2,4-triazol-4-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 170125935 |
| Molecular Formula | C24H22F3N7O |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[5-(1,2,4-triazol-4-yl)-3-pyridinyl]methanol |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CCC[C@H]2N1C(O)c1cncc(-n2cnnc2)c1 |
| InChI | InChI=1S/C24H22F3N7O/c1-32-23(13-6-18(25)21(27)19(26)7-13)17-8-15-3-2-4-20(22(17)31-32)34(15)24(35)14-5-16(10-28-9-14)33-11-29-30-12-33/h5-7,9-12,15,20,24,35H,2-4,8H2,1H3/t15-,20+,24?/m0/s1 |
| InChIKey | ZQWASCJPIBRTCU-OIBCMIKBSA-N |
| XLogP | 3.62 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|